C17H26O6 — CID 11067363
[(3S,4R)-1,1-diethoxy-4,5-dihydroxypentan-3-yl] 4-methylbenzoate (PubChem CID 11067363) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is [(3S,4R)-1,1-diethoxy-4,5-dihydroxypentan-3-yl] 4-methylbenzoate.
| Compound Name | [(3S,4R)-1,1-diethoxy-4,5-dihydroxypentan-3-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 11067363 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [(3S,4R)-1,1-diethoxy-4,5-dihydroxypentan-3-yl] 4-methylbenzoate |
| SMILES | CCOC(C[C@H](OC(=O)c1ccc(C)cc1)[C@H](O)CO)OCC |
| InChI | InChI=1S/C17H26O6/c1-4-21-16(22-5-2)10-15(14(19)11-18)23-17(20)13-8-6-12(3)7-9-13/h6-9,14-16,18-19H,4-5,10-11H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | HUAYKZPUHBOITA-CABCVRRESA-N |
| XLogP | 1.66 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|