C26H34N4O12 — CID 15690774
diethyl (5R)-2-phenyl-5-[(1R,2R,3R)-1,2,3,4-tetraacetyloxybutyl]-5H-tetrazine-3,4-dicarboxylate (PubChem CID 15690774) has the molecular formula C26H34N4O12 and a molecular weight of 594.57 g/mol. Its IUPAC name is diethyl (5R)-2-phenyl-5-[(1R,2R,3R)-1,2,3,4-tetraacetyloxybutyl]-5H-tetrazine-3,4-dicarboxylate.
| Compound Name | diethyl (5R)-2-phenyl-5-[(1R,2R,3R)-1,2,3,4-tetraacetyloxybutyl]-5H-tetrazine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15690774 |
| Molecular Formula | C26H34N4O12 |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | diethyl (5R)-2-phenyl-5-[(1R,2R,3R)-1,2,3,4-tetraacetyloxybutyl]-5H-tetrazine-3,4-dicarboxylate |
| SMILES | CCOC(=O)N1[C@@H]([C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)C=NN(c2ccccc2)N1C(=O)OCC |
| InChI | InChI=1S/C26H34N4O12/c1-7-37-25(35)28-21(14-27-29(20-12-10-9-11-13-20)30(28)26(36)38-8-2)23(41-18(5)33)24(42-19(6)34)22(40-17(4)32)15-39-16(3)31/h9-14,21-24H,7-8,15H2,1-6H3/t21-,22-,23-,24+/m1/s1 |
| InChIKey | QADPMQRURURKNH-YCAMKHIRSA-N |
| XLogP | 1.97 |
| TPSA | 179.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|