C23H27ClN2O10S — CID 100935612
[(2R,3S,4R)-2,3,4-triacetyloxy-4-[(4R,5R)-5-acetyloxy-1-(2-chlorophenyl)-2-sulfanylideneimidazolidin-4-yl]butyl] acetate (PubChem CID 100935612) has the molecular formula C23H27ClN2O10S and a molecular weight of 558.99 g/mol. Its IUPAC name is [(2R,3S,4R)-2,3,4-triacetyloxy-4-[(4R,5R)-5-acetyloxy-1-(2-chlorophenyl)-2-sulfanylideneimidazolidin-4-yl]butyl] acetate.
| Compound Name | [(2R,3S,4R)-2,3,4-triacetyloxy-4-[(4R,5R)-5-acetyloxy-1-(2-chlorophenyl)-2-sulfanylideneimidazolidin-4-yl]butyl] acetate |
|---|---|
| PubChem CID | 100935612 |
| Molecular Formula | C23H27ClN2O10S |
| Molecular Weight | 558.99 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | [(2R,3S,4R)-2,3,4-triacetyloxy-4-[(4R,5R)-5-acetyloxy-1-(2-chlorophenyl)-2-sulfanylideneimidazolidin-4-yl]butyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(=S)N(c2ccccc2Cl)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H27ClN2O10S/c1-11(27)32-10-18(33-12(2)28)20(34-13(3)29)21(35-14(4)30)19-22(36-15(5)31)26(23(37)25-19)17-9-7-6-8-16(17)24/h6-9,18-22H,10H2,1-5H3,(H,25,37)/t18-,19-,20-,21-,22-/m1/s1 |
| InChIKey | ISDLRIRCKLAKEH-ZGJYDULXSA-N |
| XLogP | 1.65 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.99 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|