C23H29NO9S — CID 53381831
[(2R,3R,4R)-2,3,4-triacetyloxy-4-[(2S,5S)-3-ethanethioyl-2-phenyl-1,3-oxazolidin-5-yl]butyl] acetate (PubChem CID 53381831) has the molecular formula C23H29NO9S and a molecular weight of 495.55 g/mol. Its IUPAC name is [(2R,3R,4R)-2,3,4-triacetyloxy-4-[(2S,5S)-3-ethanethioyl-2-phenyl-1,3-oxazolidin-5-yl]butyl] acetate.
| Compound Name | [(2R,3R,4R)-2,3,4-triacetyloxy-4-[(2S,5S)-3-ethanethioyl-2-phenyl-1,3-oxazolidin-5-yl]butyl] acetate |
|---|---|
| PubChem CID | 53381831 |
| Molecular Formula | C23H29NO9S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | [(2R,3R,4R)-2,3,4-triacetyloxy-4-[(2S,5S)-3-ethanethioyl-2-phenyl-1,3-oxazolidin-5-yl]butyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1CN(C(C)=S)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C23H29NO9S/c1-13(34)24-11-19(33-23(24)18-9-7-6-8-10-18)21(31-16(4)27)22(32-17(5)28)20(30-15(3)26)12-29-14(2)25/h6-10,19-23H,11-12H2,1-5H3/t19-,20+,21+,22+,23-/m0/s1 |
| InChIKey | NZTTUONZRVJFFA-BUPNWXMQSA-N |
| XLogP | 2.09 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|