C16H22O10 — CID 11474267
[(2R,3R,4R)-2,3,4-triacetyloxy-4-[(2R)-5-oxooxolan-2-yl]butyl] acetate (PubChem CID 11474267) has the molecular formula C16H22O10 and a molecular weight of 374.34 g/mol. Its IUPAC name is [(2R,3R,4R)-2,3,4-triacetyloxy-4-[(2R)-5-oxooxolan-2-yl]butyl] acetate.
| Compound Name | [(2R,3R,4R)-2,3,4-triacetyloxy-4-[(2R)-5-oxooxolan-2-yl]butyl] acetate |
|---|---|
| PubChem CID | 11474267 |
| Molecular Formula | C16H22O10 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [(2R,3R,4R)-2,3,4-triacetyloxy-4-[(2R)-5-oxooxolan-2-yl]butyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C16H22O10/c1-8(17)22-7-13(23-9(2)18)16(25-11(4)20)15(24-10(3)19)12-5-6-14(21)26-12/h12-13,15-16H,5-7H2,1-4H3/t12-,13-,15-,16-/m1/s1 |
| InChIKey | DRAYGRUHCIFJPW-RRCSTGOVSA-N |
| XLogP | 0.05 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|