C18H26O7 — CID 10970272
[(2R,3S)-2,3-diacetyloxy-3-[(1S,6S)-6-formyl-3,4-dimethylcyclohex-3-en-1-yl]propyl] acetate (PubChem CID 10970272) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(2R,3S)-2,3-diacetyloxy-3-[(1S,6S)-6-formyl-3,4-dimethylcyclohex-3-en-1-yl]propyl] acetate.
| Compound Name | [(2R,3S)-2,3-diacetyloxy-3-[(1S,6S)-6-formyl-3,4-dimethylcyclohex-3-en-1-yl]propyl] acetate |
|---|---|
| PubChem CID | 10970272 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(2R,3S)-2,3-diacetyloxy-3-[(1S,6S)-6-formyl-3,4-dimethylcyclohex-3-en-1-yl]propyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1CC(C)=C(C)C[C@@H]1C=O |
| InChI | InChI=1S/C18H26O7/c1-10-6-15(8-19)16(7-11(10)2)18(25-14(5)22)17(24-13(4)21)9-23-12(3)20/h8,15-18H,6-7,9H2,1-5H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | OVILBFJWKJZTDP-XDNAFOTISA-N |
| XLogP | 1.97 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|