C23H33NO12 — CID 134876889
[2,3,4,5-tetraacetyloxy-5-[(1S,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]pentyl] acetate (PubChem CID 134876889) has the molecular formula C23H33NO12 and a molecular weight of 515.51 g/mol. Its IUPAC name is [2,3,4,5-tetraacetyloxy-5-[(1S,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]pentyl] acetate.
| Compound Name | [2,3,4,5-tetraacetyloxy-5-[(1S,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]pentyl] acetate |
|---|---|
| PubChem CID | 134876889 |
| Molecular Formula | C23H33NO12 |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | [2,3,4,5-tetraacetyloxy-5-[(1S,6S)-3,4-dimethyl-6-nitrocyclohex-3-en-1-yl]pentyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)[C@H]1CC(C)=C(C)C[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C23H33NO12/c1-11-8-18(19(24(30)31)9-12(11)2)21(34-15(5)27)23(36-17(7)29)22(35-16(6)28)20(33-14(4)26)10-32-13(3)25/h18-23H,8-10H2,1-7H3/t18-,19-,20?,21?,22?,23?/m0/s1 |
| InChIKey | YGOGWWLWEGXNNP-UDZPBIDDSA-N |
| XLogP | 1.67 |
| TPSA | 174.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|