C17H23Br2NO12 — CID 134875940
[(2R,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6,7-dibromo-7-nitroheptyl] acetate (PubChem CID 134875940) has the molecular formula C17H23Br2NO12 and a molecular weight of 593.17 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6,7-dibromo-7-nitroheptyl] acetate.
| Compound Name | [(2R,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6,7-dibromo-7-nitroheptyl] acetate |
|---|---|
| PubChem CID | 134875940 |
| Molecular Formula | C17H23Br2NO12 |
| Molecular Weight | 593.17 g/mol |
| Exact Mass | 590.96 |
| IUPAC Name | [(2R,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6,7-dibromo-7-nitroheptyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(Br)C(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C17H23Br2NO12/c1-7(21)28-6-12(29-8(2)22)14(30-9(3)23)16(32-11(5)25)15(31-10(4)24)13(18)17(19)20(26)27/h12-17H,6H2,1-5H3/t12-,13?,14+,15+,16+,17?/m1/s1 |
| InChIKey | ZPOGPDKQVLYGLU-ZNXBXOSESA-N |
| XLogP | 1.04 |
| TPSA | 174.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|