C23H31NO13 — CID 101490985
[(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1R,2S,3R,4S)-1,4-dimethyl-3-nitro-7-oxabicyclo[2.2.1]hept-5-en-2-yl]pentyl] acetate (PubChem CID 101490985) has the molecular formula C23H31NO13 and a molecular weight of 529.50 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1R,2S,3R,4S)-1,4-dimethyl-3-nitro-7-oxabicyclo[2.2.1]hept-5-en-2-yl]pentyl] acetate.
| Compound Name | [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1R,2S,3R,4S)-1,4-dimethyl-3-nitro-7-oxabicyclo[2.2.1]hept-5-en-2-yl]pentyl] acetate |
|---|---|
| PubChem CID | 101490985 |
| Molecular Formula | C23H31NO13 |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1R,2S,3R,4S)-1,4-dimethyl-3-nitro-7-oxabicyclo[2.2.1]hept-5-en-2-yl]pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1[C@@H]([N+](=O)[O-])[C@]2(C)C=C[C@@]1(C)O2 |
| InChI | InChI=1S/C23H31NO13/c1-11(25)32-10-16(33-12(2)26)18(34-13(3)27)20(36-15(5)29)19(35-14(4)28)17-21(24(30)31)23(7)9-8-22(17,6)37-23/h8-9,16-21H,10H2,1-7H3/t16-,17-,18+,19+,20+,21-,22-,23+/m1/s1 |
| InChIKey | KKWKYRAUOOOSTL-BOVRBPPUSA-N |
| XLogP | 0.66 |
| TPSA | 183.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|