C21H27NO13 — CID 11953457
[(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1R,2R,3R,4S)-3-nitro-7-oxabicyclo[2.2.1]hept-5-en-2-yl]pentyl] acetate (PubChem CID 11953457) has the molecular formula C21H27NO13 and a molecular weight of 501.44 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1R,2R,3R,4S)-3-nitro-7-oxabicyclo[2.2.1]hept-5-en-2-yl]pentyl] acetate.
| Compound Name | [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1R,2R,3R,4S)-3-nitro-7-oxabicyclo[2.2.1]hept-5-en-2-yl]pentyl] acetate |
|---|---|
| PubChem CID | 11953457 |
| Molecular Formula | C21H27NO13 |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1R,2R,3R,4S)-3-nitro-7-oxabicyclo[2.2.1]hept-5-en-2-yl]pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1[C@@H]([N+](=O)[O-])[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C21H27NO13/c1-9(23)30-8-16(31-10(2)24)19(32-11(3)25)21(34-13(5)27)20(33-12(4)26)17-14-6-7-15(35-14)18(17)22(28)29/h6-7,14-21H,8H2,1-5H3/t14-,15+,16-,17+,18+,19+,20+,21+/m1/s1 |
| InChIKey | TZLXFRITKNIKJW-GNPNMZQZSA-N |
| XLogP | -0.12 |
| TPSA | 183.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|