C24H37NO13Si — CID 10099637
[(2R,3R,4R,5R)-2,3,4,5-tetraacetyloxy-5-[(1R,5R,6S)-6-nitro-5-trimethylsilyloxycyclohex-3-en-1-yl]pentyl] acetate (PubChem CID 10099637) has the molecular formula C24H37NO13Si and a molecular weight of 575.64 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5-tetraacetyloxy-5-[(1R,5R,6S)-6-nitro-5-trimethylsilyloxycyclohex-3-en-1-yl]pentyl] acetate.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5-tetraacetyloxy-5-[(1R,5R,6S)-6-nitro-5-trimethylsilyloxycyclohex-3-en-1-yl]pentyl] acetate |
|---|---|
| PubChem CID | 10099637 |
| Molecular Formula | C24H37NO13Si |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5-tetraacetyloxy-5-[(1R,5R,6S)-6-nitro-5-trimethylsilyloxycyclohex-3-en-1-yl]pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1CC=C[C@@H](O[Si](C)(C)C)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C24H37NO13Si/c1-13(26)33-12-20(34-14(2)27)23(36-16(4)29)24(37-17(5)30)22(35-15(3)28)18-10-9-11-19(21(18)25(31)32)38-39(6,7)8/h9,11,18-24H,10,12H2,1-8H3/t18-,19-,20-,21+,22-,23-,24-/m1/s1 |
| InChIKey | AFJUJICDBJTXLR-VDRZETLSSA-N |
| XLogP | 1.72 |
| TPSA | 183.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|