C22H31NO12 — CID 177427501
[(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1S,6S)-3-methyl-6-nitrocyclohex-3-en-1-yl]pentyl] acetate (PubChem CID 177427501) has the molecular formula C22H31NO12 and a molecular weight of 501.49 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1S,6S)-3-methyl-6-nitrocyclohex-3-en-1-yl]pentyl] acetate.
| Compound Name | [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1S,6S)-3-methyl-6-nitrocyclohex-3-en-1-yl]pentyl] acetate |
|---|---|
| PubChem CID | 177427501 |
| Molecular Formula | C22H31NO12 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-5-[(1S,6S)-3-methyl-6-nitrocyclohex-3-en-1-yl]pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1CC(C)=CC[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C22H31NO12/c1-11-7-8-18(23(29)30)17(9-11)20(33-14(4)26)22(35-16(6)28)21(34-15(5)27)19(32-13(3)25)10-31-12(2)24/h7,17-22H,8-10H2,1-6H3/t17-,18-,19+,20-,21-,22+/m0/s1 |
| InChIKey | ZXSCNUNTGLUOTG-KINXCBNHSA-N |
| XLogP | 1.28 |
| TPSA | 174.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|