C27H39NO14 — CID 100913888
methyl 3-[(1S,6R)-3,4-dimethyl-1-nitro-6-[(1R,2R,3R,4R)-1,2,3,4,5-pentaacetyloxypentyl]cyclohex-3-en-1-yl]propanoate (PubChem CID 100913888) has the molecular formula C27H39NO14 and a molecular weight of 601.60 g/mol. Its IUPAC name is methyl 3-[(1S,6R)-3,4-dimethyl-1-nitro-6-[(1R,2R,3R,4R)-1,2,3,4,5-pentaacetyloxypentyl]cyclohex-3-en-1-yl]propanoate.
| Compound Name | methyl 3-[(1S,6R)-3,4-dimethyl-1-nitro-6-[(1R,2R,3R,4R)-1,2,3,4,5-pentaacetyloxypentyl]cyclohex-3-en-1-yl]propanoate |
|---|---|
| PubChem CID | 100913888 |
| Molecular Formula | C27H39NO14 |
| Molecular Weight | 601.60 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | methyl 3-[(1S,6R)-3,4-dimethyl-1-nitro-6-[(1R,2R,3R,4R)-1,2,3,4,5-pentaacetyloxypentyl]cyclohex-3-en-1-yl]propanoate |
| SMILES | COC(=O)CC[C@]1([N+](=O)[O-])CC(C)=C(C)C[C@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C27H39NO14/c1-14-11-21(27(28(35)36,12-15(14)2)10-9-23(34)37-8)24(40-18(5)31)26(42-20(7)33)25(41-19(6)32)22(39-17(4)30)13-38-16(3)29/h21-22,24-26H,9-13H2,1-8H3/t21-,22+,24+,25+,26+,27-/m0/s1 |
| InChIKey | LSFXCVSUSGEYBL-QBCCSTDJSA-N |
| XLogP | 1.99 |
| TPSA | 200.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.60 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|