C24H33NO13 — CID 102587023
[(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-7-[(1R)-3-formyl-1-nitrocyclohex-3-en-1-yl]heptyl] acetate (PubChem CID 102587023) has the molecular formula C24H33NO13 and a molecular weight of 543.52 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-7-[(1R)-3-formyl-1-nitrocyclohex-3-en-1-yl]heptyl] acetate.
| Compound Name | [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-7-[(1R)-3-formyl-1-nitrocyclohex-3-en-1-yl]heptyl] acetate |
|---|---|
| PubChem CID | 102587023 |
| Molecular Formula | C24H33NO13 |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | [(2R,3S,4R,5S)-2,3,4,5-tetraacetyloxy-7-[(1R)-3-formyl-1-nitrocyclohex-3-en-1-yl]heptyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H](CC[C@]1([N+](=O)[O-])CCC=C(C=O)C1)OC(C)=O |
| InChI | InChI=1S/C24H33NO13/c1-14(27)34-13-21(36-16(3)29)23(38-18(5)31)22(37-17(4)30)20(35-15(2)28)8-10-24(25(32)33)9-6-7-19(11-24)12-26/h7,12,20-23H,6,8-11,13H2,1-5H3/t20-,21+,22+,23-,24+/m0/s1 |
| InChIKey | RZHVDRXEBAXFMP-UDIRQSBCSA-N |
| XLogP | 1.38 |
| TPSA | 191.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|