C29H41NO15 — CID 177483874
methyl (2S)-2-[(1S,6R)-3,4-dimethyl-1-nitro-6-[(1R,2R,3R,4R)-1,2,3,4,5-pentaacetyloxypentyl]cyclohex-3-en-1-yl]-4-oxopentanoate (PubChem CID 177483874) has the molecular formula C29H41NO15 and a molecular weight of 643.64 g/mol. Its IUPAC name is methyl (2S)-2-[(1S,6R)-3,4-dimethyl-1-nitro-6-[(1R,2R,3R,4R)-1,2,3,4,5-pentaacetyloxypentyl]cyclohex-3-en-1-yl]-4-oxopentanoate.
| Compound Name | methyl (2S)-2-[(1S,6R)-3,4-dimethyl-1-nitro-6-[(1R,2R,3R,4R)-1,2,3,4,5-pentaacetyloxypentyl]cyclohex-3-en-1-yl]-4-oxopentanoate |
|---|---|
| PubChem CID | 177483874 |
| Molecular Formula | C29H41NO15 |
| Molecular Weight | 643.64 g/mol |
| Exact Mass | 643.25 |
| IUPAC Name | methyl (2S)-2-[(1S,6R)-3,4-dimethyl-1-nitro-6-[(1R,2R,3R,4R)-1,2,3,4,5-pentaacetyloxypentyl]cyclohex-3-en-1-yl]-4-oxopentanoate |
| SMILES | COC(=O)[C@@H](CC(C)=O)[C@]1([N+](=O)[O-])CC(C)=C(C)C[C@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C29H41NO15/c1-14-10-22(29(30(38)39,12-15(14)2)23(11-16(3)31)28(37)40-9)25(43-19(6)34)27(45-21(8)36)26(44-20(7)35)24(42-18(5)33)13-41-17(4)32/h22-27H,10-13H2,1-9H3/t22-,23+,24+,25+,26+,27+,29-/m0/s1 |
| InChIKey | UJQIAQVWGFLQEP-UOSSPILMSA-N |
| XLogP | 1.81 |
| TPSA | 218.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.64 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|