C25H29FN2O11S — CID 100935619
[(2R,3S,4R)-4-[(4R,5R)-3-acetyl-5-acetyloxy-1-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-yl]-2,3,4-triacetyloxybutyl] acetate (PubChem CID 100935619) has the molecular formula C25H29FN2O11S and a molecular weight of 584.58 g/mol. Its IUPAC name is [(2R,3S,4R)-4-[(4R,5R)-3-acetyl-5-acetyloxy-1-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-yl]-2,3,4-triacetyloxybutyl] acetate.
| Compound Name | [(2R,3S,4R)-4-[(4R,5R)-3-acetyl-5-acetyloxy-1-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-yl]-2,3,4-triacetyloxybutyl] acetate |
|---|---|
| PubChem CID | 100935619 |
| Molecular Formula | C25H29FN2O11S |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | [(2R,3S,4R)-4-[(4R,5R)-3-acetyl-5-acetyloxy-1-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-yl]-2,3,4-triacetyloxybutyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1[C@@H](OC(C)=O)N(c2ccccc2F)C(=S)N1C(C)=O |
| InChI | InChI=1S/C25H29FN2O11S/c1-12(29)27-21(24(39-17(6)34)28(25(27)40)19-10-8-7-9-18(19)26)23(38-16(5)33)22(37-15(4)32)20(36-14(3)31)11-35-13(2)30/h7-10,20-24H,11H2,1-6H3/t20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | PTVCVJRWTXYWMI-MRKXFKPJSA-N |
| XLogP | 1.40 |
| TPSA | 155.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|