C21H24N2O8S — CID 25085912
[(2R)-2-[(1R,5S,7S,8R)-2-acetyl-8-acetyloxy-4-phenyl-3-sulfanylidene-6-oxa-2,4-diazabicyclo[3.2.1]octan-7-yl]-2-acetyloxyethyl] acetate (PubChem CID 25085912) has the molecular formula C21H24N2O8S and a molecular weight of 464.50 g/mol. Its IUPAC name is [(2R)-2-[(1R,5S,7S,8R)-2-acetyl-8-acetyloxy-4-phenyl-3-sulfanylidene-6-oxa-2,4-diazabicyclo[3.2.1]octan-7-yl]-2-acetyloxyethyl] acetate.
| Compound Name | [(2R)-2-[(1R,5S,7S,8R)-2-acetyl-8-acetyloxy-4-phenyl-3-sulfanylidene-6-oxa-2,4-diazabicyclo[3.2.1]octan-7-yl]-2-acetyloxyethyl] acetate |
|---|---|
| PubChem CID | 25085912 |
| Molecular Formula | C21H24N2O8S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [(2R)-2-[(1R,5S,7S,8R)-2-acetyl-8-acetyloxy-4-phenyl-3-sulfanylidene-6-oxa-2,4-diazabicyclo[3.2.1]octan-7-yl]-2-acetyloxyethyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H]1O[C@H]2[C@H](OC(C)=O)[C@@H]1N(C(C)=O)C(=S)N2c1ccccc1 |
| InChI | InChI=1S/C21H24N2O8S/c1-11(24)22-17-18(16(29-13(3)26)10-28-12(2)25)31-20(19(17)30-14(4)27)23(21(22)32)15-8-6-5-7-9-15/h5-9,16-20H,10H2,1-4H3/t16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | KESAKCWWHJWYCB-WAPOTWQKSA-N |
| XLogP | 1.16 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|