C18H22O8 — CID 23250979
[(4R,5R)-5-[(1R)-1,2-diacetyloxyethyl]-2-phenyl-1,3-dioxolan-4-yl]methyl acetate (PubChem CID 23250979) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is [(4R,5R)-5-[(1R)-1,2-diacetyloxyethyl]-2-phenyl-1,3-dioxolan-4-yl]methyl acetate.
| Compound Name | [(4R,5R)-5-[(1R)-1,2-diacetyloxyethyl]-2-phenyl-1,3-dioxolan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 23250979 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | [(4R,5R)-5-[(1R)-1,2-diacetyloxyethyl]-2-phenyl-1,3-dioxolan-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H]1OC(c2ccccc2)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C18H22O8/c1-11(19)22-9-15(24-13(3)21)17-16(10-23-12(2)20)25-18(26-17)14-7-5-4-6-8-14/h4-8,15-18H,9-10H2,1-3H3/t15-,16-,17+,18?/m1/s1 |
| InChIKey | SMEHQGMKHWDLLA-HRBLRVMOSA-N |
| XLogP | 1.53 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|