C34H30O11 — CID 134337596
[5-acetyloxy-6-(1,2-dibenzoyloxyethyl)-2-(furan-2-yl)-1,3-dioxan-4-yl]methyl benzoate (PubChem CID 134337596) has the molecular formula C34H30O11 and a molecular weight of 614.60 g/mol. Its IUPAC name is [5-acetyloxy-6-(1,2-dibenzoyloxyethyl)-2-(furan-2-yl)-1,3-dioxan-4-yl]methyl benzoate.
| Compound Name | [5-acetyloxy-6-(1,2-dibenzoyloxyethyl)-2-(furan-2-yl)-1,3-dioxan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 134337596 |
| Molecular Formula | C34H30O11 |
| Molecular Weight | 614.60 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | [5-acetyloxy-6-(1,2-dibenzoyloxyethyl)-2-(furan-2-yl)-1,3-dioxan-4-yl]methyl benzoate |
| SMILES | CC(=O)OC1C(COC(=O)c2ccccc2)OC(c2ccco2)OC1C(COC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H30O11/c1-22(35)42-29-28(21-41-32(37)24-14-7-3-8-15-24)44-34(26-18-11-19-39-26)45-30(29)27(43-33(38)25-16-9-4-10-17-25)20-40-31(36)23-12-5-2-6-13-23/h2-19,27-30,34H,20-21H2,1H3 |
| InChIKey | QZYDRJMOKWDMQR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 136.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|