C27H29N7O12 — CID 71733404
[(2R,3S,4R)-4-[3-acetyl-5-[[5-[(1,3-dioxoisoindol-2-yl)methyl]tetrazol-2-yl]methyl]-2H-1,3,4-oxadiazol-2-yl]-2,3,4-triacetyloxybutyl] acetate (PubChem CID 71733404) has the molecular formula C27H29N7O12 and a molecular weight of 643.57 g/mol. Its IUPAC name is [(2R,3S,4R)-4-[3-acetyl-5-[[5-[(1,3-dioxoisoindol-2-yl)methyl]tetrazol-2-yl]methyl]-2H-1,3,4-oxadiazol-2-yl]-2,3,4-triacetyloxybutyl] acetate.
| Compound Name | [(2R,3S,4R)-4-[3-acetyl-5-[[5-[(1,3-dioxoisoindol-2-yl)methyl]tetrazol-2-yl]methyl]-2H-1,3,4-oxadiazol-2-yl]-2,3,4-triacetyloxybutyl] acetate |
|---|---|
| PubChem CID | 71733404 |
| Molecular Formula | C27H29N7O12 |
| Molecular Weight | 643.57 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | [(2R,3S,4R)-4-[3-acetyl-5-[[5-[(1,3-dioxoisoindol-2-yl)methyl]tetrazol-2-yl]methyl]-2H-1,3,4-oxadiazol-2-yl]-2,3,4-triacetyloxybutyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C1OC(Cn2nnc(CN3C(=O)c4ccccc4C3=O)n2)=NN1C(C)=O |
| InChI | InChI=1S/C27H29N7O12/c1-13(35)34-27(24(45-17(5)39)23(44-16(4)38)20(43-15(3)37)12-42-14(2)36)46-22(30-34)11-33-29-21(28-31-33)10-32-25(40)18-8-6-7-9-19(18)26(32)41/h6-9,20,23-24,27H,10-12H2,1-5H3/t20-,23+,24-,27?/m1/s1 |
| InChIKey | IHHJCKPCHOEOTM-ZPQCXQRGSA-N |
| XLogP | -0.65 |
| TPSA | 228.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.57 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|