C28H31NO9 — CID 56958152
[(2R,3S,4R)-3,4-diacetyloxy-2-formyloxy-4-[(4R)-2-methyl-6,6-diphenyl-4,5-dihydro-1,3-oxazin-4-yl]butyl] acetate (PubChem CID 56958152) has the molecular formula C28H31NO9 and a molecular weight of 525.55 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-diacetyloxy-2-formyloxy-4-[(4R)-2-methyl-6,6-diphenyl-4,5-dihydro-1,3-oxazin-4-yl]butyl] acetate.
| Compound Name | [(2R,3S,4R)-3,4-diacetyloxy-2-formyloxy-4-[(4R)-2-methyl-6,6-diphenyl-4,5-dihydro-1,3-oxazin-4-yl]butyl] acetate |
|---|---|
| PubChem CID | 56958152 |
| Molecular Formula | C28H31NO9 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | [(2R,3S,4R)-3,4-diacetyloxy-2-formyloxy-4-[(4R)-2-methyl-6,6-diphenyl-4,5-dihydro-1,3-oxazin-4-yl]butyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1CC(c2ccccc2)(c2ccccc2)OC(C)=N1 |
| InChI | InChI=1S/C28H31NO9/c1-18-29-24(15-28(38-18,22-11-7-5-8-12-22)23-13-9-6-10-14-23)26(36-20(3)32)27(37-21(4)33)25(35-17-30)16-34-19(2)31/h5-14,17,24-27H,15-16H2,1-4H3/t24-,25-,26-,27-/m1/s1 |
| InChIKey | RIABHGPBLFSVLP-FPCALVHFSA-N |
| XLogP | 3.11 |
| TPSA | 126.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|