C10H13BrO6 — CID 102391789
[(Z,2R,3S)-3-acetyloxy-5-bromo-2-formyloxypent-4-enyl] acetate (PubChem CID 102391789) has the molecular formula C10H13BrO6 and a molecular weight of 309.11 g/mol. Its IUPAC name is [(Z,2R,3S)-3-acetyloxy-5-bromo-2-formyloxypent-4-enyl] acetate.
| Compound Name | [(Z,2R,3S)-3-acetyloxy-5-bromo-2-formyloxypent-4-enyl] acetate |
|---|---|
| PubChem CID | 102391789 |
| Molecular Formula | C10H13BrO6 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | [(Z,2R,3S)-3-acetyloxy-5-bromo-2-formyloxypent-4-enyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC=O)[C@H](/C=C\Br)OC(C)=O |
| InChI | InChI=1S/C10H13BrO6/c1-7(13)15-5-10(16-6-12)9(3-4-11)17-8(2)14/h3-4,6,9-10H,5H2,1-2H3/b4-3-/t9-,10+/m0/s1 |
| InChIKey | GRCOMNGEOUXQMF-RWCMCFKCSA-N |
| XLogP | 0.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|