C12H16ClIO8 — CID 101139602
[(2R,3S,4S)-3,4-diacetyloxy-5-chloro-2-formyloxy-5-iodopentyl] acetate (PubChem CID 101139602) has the molecular formula C12H16ClIO8 and a molecular weight of 450.61 g/mol. Its IUPAC name is [(2R,3S,4S)-3,4-diacetyloxy-5-chloro-2-formyloxy-5-iodopentyl] acetate.
| Compound Name | [(2R,3S,4S)-3,4-diacetyloxy-5-chloro-2-formyloxy-5-iodopentyl] acetate |
|---|---|
| PubChem CID | 101139602 |
| Molecular Formula | C12H16ClIO8 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | [(2R,3S,4S)-3,4-diacetyloxy-5-chloro-2-formyloxy-5-iodopentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC=O)[C@H](OC(C)=O)[C@H](OC(C)=O)C(Cl)I |
| InChI | InChI=1S/C12H16ClIO8/c1-6(16)19-4-9(20-5-15)10(21-7(2)17)11(12(13)14)22-8(3)18/h5,9-12H,4H2,1-3H3/t9-,10+,11+,12?/m1/s1 |
| InChIKey | AEVCLMITUVXLPU-FEZOTEKNSA-N |
| XLogP | 0.95 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|