C13H18O8 — CID 102463041
[(2R,4S,5S)-4,5-diacetyloxy-2-formyl-6-oxohexyl] acetate (PubChem CID 102463041) has the molecular formula C13H18O8 and a molecular weight of 302.28 g/mol. Its IUPAC name is [(2R,4S,5S)-4,5-diacetyloxy-2-formyl-6-oxohexyl] acetate.
| Compound Name | [(2R,4S,5S)-4,5-diacetyloxy-2-formyl-6-oxohexyl] acetate |
|---|---|
| PubChem CID | 102463041 |
| Molecular Formula | C13H18O8 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | [(2R,4S,5S)-4,5-diacetyloxy-2-formyl-6-oxohexyl] acetate |
| SMILES | CC(=O)OC[C@H](C=O)C[C@H](OC(C)=O)[C@@H](C=O)OC(C)=O |
| InChI | InChI=1S/C13H18O8/c1-8(16)19-7-11(5-14)4-12(20-9(2)17)13(6-15)21-10(3)18/h5-6,11-13H,4,7H2,1-3H3/t11-,12-,13+/m0/s1 |
| InChIKey | QTPYEIJHLAOZPX-RWMBFGLXSA-N |
| XLogP | -0.18 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|