C31H38N2O15 — CID 100960887
[(2R,3S,4R)-2,3,4,5-tetraacetyloxy-5-[(1S,2S,6R,10S,12S)-10-ethoxy-3,5-dioxo-4-phenyl-7,9-dioxa-4,8-diazatricyclo[6.4.0.02,6]dodecan-12-yl]pentyl] acetate (PubChem CID 100960887) has the molecular formula C31H38N2O15 and a molecular weight of 678.64 g/mol. Its IUPAC name is [(2R,3S,4R)-2,3,4,5-tetraacetyloxy-5-[(1S,2S,6R,10S,12S)-10-ethoxy-3,5-dioxo-4-phenyl-7,9-dioxa-4,8-diazatricyclo[6.4.0.02,6]dodecan-12-yl]pentyl] acetate.
| Compound Name | [(2R,3S,4R)-2,3,4,5-tetraacetyloxy-5-[(1S,2S,6R,10S,12S)-10-ethoxy-3,5-dioxo-4-phenyl-7,9-dioxa-4,8-diazatricyclo[6.4.0.02,6]dodecan-12-yl]pentyl] acetate |
|---|---|
| PubChem CID | 100960887 |
| Molecular Formula | C31H38N2O15 |
| Molecular Weight | 678.64 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | [(2R,3S,4R)-2,3,4,5-tetraacetyloxy-5-[(1S,2S,6R,10S,12S)-10-ethoxy-3,5-dioxo-4-phenyl-7,9-dioxa-4,8-diazatricyclo[6.4.0.02,6]dodecan-12-yl]pentyl] acetate |
| SMILES | CCO[C@@H]1C[C@H](C(OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H]2[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3ON2O1 |
| InChI | InChI=1S/C31H38N2O15/c1-7-41-23-13-21(25-24-28(48-33(25)47-23)31(40)32(30(24)39)20-11-9-8-10-12-20)26(44-17(4)36)29(46-19(6)38)27(45-18(5)37)22(43-16(3)35)14-42-15(2)34/h8-12,21-29H,7,13-14H2,1-6H3/t21-,22+,23-,24-,25-,26?,27-,28+,29+/m0/s1 |
| InChIKey | HIWIZQWWPSFVHW-PPLRMAQJSA-N |
| XLogP | 0.76 |
| TPSA | 199.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.64 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|