C27H25N3O6 — CID 10601013
(1R,2S,6R,10R,12S)-10-[(4-methoxyphenyl)methoxy]-4-phenyl-12-pyridin-3-yl-7,9-dioxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione (PubChem CID 10601013) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is (1R,2S,6R,10R,12S)-10-[(4-methoxyphenyl)methoxy]-4-phenyl-12-pyridin-3-yl-7,9-dioxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione.
| Compound Name | (1R,2S,6R,10R,12S)-10-[(4-methoxyphenyl)methoxy]-4-phenyl-12-pyridin-3-yl-7,9-dioxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione |
|---|---|
| PubChem CID | 10601013 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (1R,2S,6R,10R,12S)-10-[(4-methoxyphenyl)methoxy]-4-phenyl-12-pyridin-3-yl-7,9-dioxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5-dione |
| SMILES | COc1ccc(CO[C@H]2C[C@@H](c3cccnc3)[C@@H]3[C@@H]4C(=O)N(c5ccccc5)C(=O)[C@@H]4ON3O2)cc1 |
| InChI | InChI=1S/C27H25N3O6/c1-33-20-11-9-17(10-12-20)16-34-22-14-21(18-6-5-13-28-15-18)24-23-25(36-30(24)35-22)27(32)29(26(23)31)19-7-3-2-4-8-19/h2-13,15,21-25H,14,16H2,1H3/t21-,22+,23-,24+,25+/m0/s1 |
| InChIKey | PJSYYDOBEOLJBQ-HNRDJRCMSA-N |
| XLogP | 3.23 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|