C11H16FN3O — CID 63767489
1-(1-aminobutan-2-yl)-3-(2-fluorophenyl)urea (PubChem CID 63767489) has the molecular formula C11H16FN3O and a molecular weight of 225.27 g/mol. Its IUPAC name is 1-(1-aminobutan-2-yl)-3-(2-fluorophenyl)urea.
| Compound Name | 1-(1-aminobutan-2-yl)-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 63767489 |
| Molecular Formula | C11H16FN3O |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-(1-aminobutan-2-yl)-3-(2-fluorophenyl)urea |
| SMILES | CCC(CN)NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C11H16FN3O/c1-2-8(7-13)14-11(16)15-10-6-4-3-5-9(10)12/h3-6,8H,2,7,13H2,1H3,(H2,14,15,16) |
| InChIKey | YWVUXXGWQJRQSH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |