C13H19F2NS — CID 43095111
2-(difluoromethylsulfanyl)-N-(2-methylpentyl)aniline (PubChem CID 43095111) has the molecular formula C13H19F2NS and a molecular weight of 259.37 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-(2-methylpentyl)aniline.
| Compound Name | 2-(difluoromethylsulfanyl)-N-(2-methylpentyl)aniline |
|---|---|
| PubChem CID | 43095111 |
| Molecular Formula | C13H19F2NS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-(2-methylpentyl)aniline |
| SMILES | CCCC(C)CNc1ccccc1SC(F)F |
| InChI | InChI=1S/C13H19F2NS/c1-3-6-10(2)9-16-11-7-4-5-8-12(11)17-13(14)15/h4-5,7-8,10,13,16H,3,6,9H2,1-2H3 |
| InChIKey | HESAHKADEKYAJJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |