C10H14Cl2N2O2S — CID 104726640
3-amino-N-(2,5-dichloro-4-methylphenyl)propane-1-sulfonamide (PubChem CID 104726640) has the molecular formula C10H14Cl2N2O2S and a molecular weight of 297.21 g/mol. Its IUPAC name is 3-amino-N-(2,5-dichloro-4-methylphenyl)propane-1-sulfonamide.
| Compound Name | 3-amino-N-(2,5-dichloro-4-methylphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 104726640 |
| Molecular Formula | C10H14Cl2N2O2S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 3-amino-N-(2,5-dichloro-4-methylphenyl)propane-1-sulfonamide |
| SMILES | Cc1cc(Cl)c(NS(=O)(=O)CCCN)cc1Cl |
| InChI | InChI=1S/C10H14Cl2N2O2S/c1-7-5-9(12)10(6-8(7)11)14-17(15,16)4-2-3-13/h5-6,14H,2-4,13H2,1H3 |
| InChIKey | ASVIHHPSAUHHAX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |