C12H19ClN2O3S — CID 106056915
4-amino-N-(4-chloro-2-methoxy-5-methylphenyl)butane-1-sulfonamide (PubChem CID 106056915) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.81 g/mol. Its IUPAC name is 4-amino-N-(4-chloro-2-methoxy-5-methylphenyl)butane-1-sulfonamide.
| Compound Name | 4-amino-N-(4-chloro-2-methoxy-5-methylphenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106056915 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-amino-N-(4-chloro-2-methoxy-5-methylphenyl)butane-1-sulfonamide |
| SMILES | COc1cc(Cl)c(C)cc1NS(=O)(=O)CCCCN |
| InChI | InChI=1S/C12H19ClN2O3S/c1-9-7-11(12(18-2)8-10(9)13)15-19(16,17)6-4-3-5-14/h7-8,15H,3-6,14H2,1-2H3 |
| InChIKey | MZIOPAQXVOULSD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|