C9H9Cl2NO3S — CID 80979145
4-[(Z)-2,3-dichloroprop-2-enoxy]benzenesulfonamide (PubChem CID 80979145) has the molecular formula C9H9Cl2NO3S and a molecular weight of 282.15 g/mol. Its IUPAC name is 4-[(Z)-2,3-dichloroprop-2-enoxy]benzenesulfonamide.
| Compound Name | 4-[(Z)-2,3-dichloroprop-2-enoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 80979145 |
| Molecular Formula | C9H9Cl2NO3S |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 4-[(Z)-2,3-dichloroprop-2-enoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OC/C(Cl)=C/Cl)cc1 |
| InChI | InChI=1S/C9H9Cl2NO3S/c10-5-7(11)6-15-8-1-3-9(4-2-8)16(12,13)14/h1-5H,6H2,(H2,12,13,14)/b7-5- |
| InChIKey | BMERRPIBQWMZJM-ALCCZGGFSA-N |
| XLogP | 2.03 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |