C8H9F2NO3S — CID 60923217
4-(2,2-difluoroethoxy)benzenesulfonamide (PubChem CID 60923217) has the molecular formula C8H9F2NO3S and a molecular weight of 237.23 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)benzenesulfonamide.
| Compound Name | 4-(2,2-difluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 60923217 |
| Molecular Formula | C8H9F2NO3S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 4-(2,2-difluoroethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCC(F)F)cc1 |
| InChI | InChI=1S/C8H9F2NO3S/c9-8(10)5-14-6-1-3-7(4-2-6)15(11,12)13/h1-4,8H,5H2,(H2,11,12,13) |
| InChIKey | PEDQBXDETFRGTM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |