C16H24F2N2O3S — CID 120710791
N-(2-amino-1-cyclohexylethyl)-4-(2,2-difluoroethoxy)benzenesulfonamide (PubChem CID 120710791) has the molecular formula C16H24F2N2O3S and a molecular weight of 362.44 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-4-(2,2-difluoroethoxy)benzenesulfonamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-4-(2,2-difluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 120710791 |
| Molecular Formula | C16H24F2N2O3S |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-4-(2,2-difluoroethoxy)benzenesulfonamide |
| SMILES | NCC(NS(=O)(=O)c1ccc(OCC(F)F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C16H24F2N2O3S/c17-16(18)11-23-13-6-8-14(9-7-13)24(21,22)20-15(10-19)12-4-2-1-3-5-12/h6-9,12,15-16,20H,1-5,10-11,19H2 |
| InChIKey | JCYGAPNEHRPQLO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |