C14H20F2N2O3S — CID 75477000
4-(2,2-difluoroethoxy)-N-(1-methylpiperidin-4-yl)benzenesulfonamide (PubChem CID 75477000) has the molecular formula C14H20F2N2O3S and a molecular weight of 334.39 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N-(1-methylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 4-(2,2-difluoroethoxy)-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 75477000 |
| Molecular Formula | C14H20F2N2O3S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N-(1-methylpiperidin-4-yl)benzenesulfonamide |
| SMILES | CN1CCC(NS(=O)(=O)c2ccc(OCC(F)F)cc2)CC1 |
| InChI | InChI=1S/C14H20F2N2O3S/c1-18-8-6-11(7-9-18)17-22(19,20)13-4-2-12(3-5-13)21-10-14(15)16/h2-5,11,14,17H,6-10H2,1H3 |
| InChIKey | ZYUPXQYQONBNKM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |