C12H18F2N2O3S — CID 120824764
4-(2,2-difluoroethoxy)-N-[2-(methylamino)propyl]benzenesulfonamide (PubChem CID 120824764) has the molecular formula C12H18F2N2O3S and a molecular weight of 308.35 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N-[2-(methylamino)propyl]benzenesulfonamide.
| Compound Name | 4-(2,2-difluoroethoxy)-N-[2-(methylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 120824764 |
| Molecular Formula | C12H18F2N2O3S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N-[2-(methylamino)propyl]benzenesulfonamide |
| SMILES | CNC(C)CNS(=O)(=O)c1ccc(OCC(F)F)cc1 |
| InChI | InChI=1S/C12H18F2N2O3S/c1-9(15-2)7-16-20(17,18)11-5-3-10(4-6-11)19-8-12(13)14/h3-6,9,12,15-16H,7-8H2,1-2H3 |
| InChIKey | HJJNFZPVMHTFRK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |