C12H17F3N2O2S — CID 120825538
4-methyl-N-[2-(methylamino)propyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 120825538) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-methyl-N-[2-(methylamino)propyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-(methylamino)propyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120825538 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-methyl-N-[2-(methylamino)propyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CNC(C)CNS(=O)(=O)c1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3N2O2S/c1-8-4-5-10(6-11(8)12(13,14)15)20(18,19)17-7-9(2)16-3/h4-6,9,16-17H,7H2,1-3H3 |
| InChIKey | MEWBKSDSELUYGQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |