C11H16ClF3N2O2S2 — CID 120824647
N-[2-(methylamino)propyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide;hydrochloride (PubChem CID 120824647) has the molecular formula C11H16ClF3N2O2S2 and a molecular weight of 364.84 g/mol. Its IUPAC name is N-[2-(methylamino)propyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(methylamino)propyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120824647 |
| Molecular Formula | C11H16ClF3N2O2S2 |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | N-[2-(methylamino)propyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide;hydrochloride |
| SMILES | CNC(C)CNS(=O)(=O)c1ccc(SC(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C11H15F3N2O2S2.ClH/c1-8(15-2)7-16-20(17,18)10-5-3-9(4-6-10)19-11(12,13)14;/h3-6,8,15-16H,7H2,1-2H3;1H |
| InChIKey | UJFKUMGSNPKBBL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |