C11H15F3N2O2S2 — CID 119973962
N-[2-(ethylamino)ethyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide (PubChem CID 119973962) has the molecular formula C11H15F3N2O2S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide.
| Compound Name | N-[2-(ethylamino)ethyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119973962 |
| Molecular Formula | C11H15F3N2O2S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-4-(trifluoromethylsulfanyl)benzenesulfonamide |
| SMILES | CCNCCNS(=O)(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H15F3N2O2S2/c1-2-15-7-8-16-20(17,18)10-5-3-9(4-6-10)19-11(12,13)14/h3-6,15-16H,2,7-8H2,1H3 |
| InChIKey | FRMYUEUKGGVYAX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|