C12H16F3NO2S2 — CID 47425286
N-(2-methylbutan-2-yl)-4-(trifluoromethylsulfanyl)benzenesulfonamide (PubChem CID 47425286) has the molecular formula C12H16F3NO2S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-(2-methylbutan-2-yl)-4-(trifluoromethylsulfanyl)benzenesulfonamide.
| Compound Name | N-(2-methylbutan-2-yl)-4-(trifluoromethylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47425286 |
| Molecular Formula | C12H16F3NO2S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-(2-methylbutan-2-yl)-4-(trifluoromethylsulfanyl)benzenesulfonamide |
| SMILES | CCC(C)(C)NS(=O)(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3NO2S2/c1-4-11(2,3)16-20(17,18)10-7-5-9(6-8-10)19-12(13,14)15/h5-8,16H,4H2,1-3H3 |
| InChIKey | PRDMOIXLIZJLIP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |