C10H11NO5S — CID 167862946
2-[(4-sulfamoylphenoxy)methyl]prop-2-enoic acid (PubChem CID 167862946) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-[(4-sulfamoylphenoxy)methyl]prop-2-enoic acid.
| Compound Name | 2-[(4-sulfamoylphenoxy)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 167862946 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-[(4-sulfamoylphenoxy)methyl]prop-2-enoic acid |
| SMILES | C=C(COc1ccc(S(N)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C10H11NO5S/c1-7(10(12)13)6-16-8-2-4-9(5-3-8)17(11,14)15/h2-5H,1,6H2,(H,12,13)(H2,11,14,15) |
| InChIKey | LRFDVZTYEBZRKS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|