C10H12NaO4S — CID 131845691
CID 131845691 (PubChem CID 131845691) has the molecular formula C10H12NaO4S and a molecular weight of 251.26 g/mol.
| Compound Name | CID 131845691 |
|---|---|
| PubChem CID | 131845691 |
| Molecular Formula | C10H12NaO4S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | — |
| SMILES | C=C(C)COc1ccc(S(=O)(=O)O)cc1.[Na] |
| InChI | InChI=1S/C10H12O4S.Na/c1-8(2)7-14-9-3-5-10(6-4-9)15(11,12)13;/h3-6H,1,7H2,2H3,(H,11,12,13); |
| InChIKey | DTCNGBHAEDSVIU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|