C11H13NO2 — CID 10559618
N-[4-(2-methylprop-2-enoxy)phenyl]formamide (PubChem CID 10559618) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is N-[4-(2-methylprop-2-enoxy)phenyl]formamide.
| Compound Name | N-[4-(2-methylprop-2-enoxy)phenyl]formamide |
|---|---|
| PubChem CID | 10559618 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | N-[4-(2-methylprop-2-enoxy)phenyl]formamide |
| SMILES | C=C(C)COc1ccc(NC=O)cc1 |
| InChI | InChI=1S/C11H13NO2/c1-9(2)7-14-11-5-3-10(4-6-11)12-8-13/h3-6,8H,1,7H2,2H3,(H,12,13) |
| InChIKey | QSDTUGRKCHTFDJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|