C11H10N2O6S — CID 167809217
2-[(4-sulfamoylphenoxy)methyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 167809217) has the molecular formula C11H10N2O6S and a molecular weight of 298.28 g/mol. Its IUPAC name is 2-[(4-sulfamoylphenoxy)methyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[(4-sulfamoylphenoxy)methyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 167809217 |
| Molecular Formula | C11H10N2O6S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-[(4-sulfamoylphenoxy)methyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(OCc2nc(C(=O)O)co2)cc1 |
| InChI | InChI=1S/C11H10N2O6S/c12-20(16,17)8-3-1-7(2-4-8)18-6-10-13-9(5-19-10)11(14)15/h1-5H,6H2,(H,14,15)(H2,12,16,17) |
| InChIKey | BZWNBWGZDALFNT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |