C18H21NO5S — CID 8568254
2-(4-sulfamoylphenoxy)ethyl 2-methyl-2-phenylpropanoate (PubChem CID 8568254) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl 2-methyl-2-phenylpropanoate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 8568254 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl 2-methyl-2-phenylpropanoate |
| SMILES | CC(C)(C(=O)OCCOc1ccc(S(N)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO5S/c1-18(2,14-6-4-3-5-7-14)17(20)24-13-12-23-15-8-10-16(11-9-15)25(19,21)22/h3-11H,12-13H2,1-2H3,(H2,19,21,22) |
| InChIKey | YRXPCTSHNQTFNA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|