C18H17N3O5S — CID 40661255
2-(4-sulfamoylphenoxy)ethyl 3-phenyl-1H-pyrazole-5-carboxylate (PubChem CID 40661255) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl 3-phenyl-1H-pyrazole-5-carboxylate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl 3-phenyl-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 40661255 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl 3-phenyl-1H-pyrazole-5-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(OCCOC(=O)c2cc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C18H17N3O5S/c19-27(23,24)15-8-6-14(7-9-15)25-10-11-26-18(22)17-12-16(20-21-17)13-4-2-1-3-5-13/h1-9,12H,10-11H2,(H,20,21)(H2,19,23,24) |
| InChIKey | SEFLVGXFZUATCQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|