C20H17N3O5S3 — CID 34295762
2-(4-sulfamoylphenoxy)ethyl 2-anilinothieno[2,3-d][1,3]thiazole-5-carboxylate (PubChem CID 34295762) has the molecular formula C20H17N3O5S3 and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl 2-anilinothieno[2,3-d][1,3]thiazole-5-carboxylate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl 2-anilinothieno[2,3-d][1,3]thiazole-5-carboxylate |
|---|---|
| PubChem CID | 34295762 |
| Molecular Formula | C20H17N3O5S3 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl 2-anilinothieno[2,3-d][1,3]thiazole-5-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(OCCOC(=O)c2cc3sc(Nc4ccccc4)nc3s2)cc1 |
| InChI | InChI=1S/C20H17N3O5S3/c21-31(25,26)15-8-6-14(7-9-15)27-10-11-28-19(24)17-12-16-18(29-17)23-20(30-16)22-13-4-2-1-3-5-13/h1-9,12H,10-11H2,(H,22,23)(H2,21,25,26) |
| InChIKey | KSJGHQWHUDVURC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|