C17H13N3O2S2 — CID 17489929
2-anilino-N-(furan-2-ylmethyl)thieno[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 17489929) has the molecular formula C17H13N3O2S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-anilino-N-(furan-2-ylmethyl)thieno[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 2-anilino-N-(furan-2-ylmethyl)thieno[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 17489929 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-anilino-N-(furan-2-ylmethyl)thieno[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | O=C(NCc1ccco1)c1cc2sc(Nc3ccccc3)nc2s1 |
| InChI | InChI=1S/C17H13N3O2S2/c21-15(18-10-12-7-4-8-22-12)13-9-14-16(23-13)20-17(24-14)19-11-5-2-1-3-6-11/h1-9H,10H2,(H,18,21)(H,19,20) |
| InChIKey | ISAMMSLBMQHTIF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |