C16H15N3O2S — CID 27377722
2-(2-anilino-1,3-thiazol-4-yl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 27377722) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-(2-anilino-1,3-thiazol-4-yl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(2-anilino-1,3-thiazol-4-yl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 27377722 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(2-anilino-1,3-thiazol-4-yl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1csc(Nc2ccccc2)n1)NCc1ccco1 |
| InChI | InChI=1S/C16H15N3O2S/c20-15(17-10-14-7-4-8-21-14)9-13-11-22-16(19-13)18-12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H,17,20)(H,18,19) |
| InChIKey | KRNMEFJXEYVILJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |