C19H16FNO5S2 — CID 46608934
2-(4-sulfamoylphenoxy)ethyl 5-(4-fluorophenyl)thiophene-2-carboxylate (PubChem CID 46608934) has the molecular formula C19H16FNO5S2 and a molecular weight of 421.47 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl 5-(4-fluorophenyl)thiophene-2-carboxylate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl 5-(4-fluorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 46608934 |
| Molecular Formula | C19H16FNO5S2 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl 5-(4-fluorophenyl)thiophene-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(OCCOC(=O)c2ccc(-c3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C19H16FNO5S2/c20-14-3-1-13(2-4-14)17-9-10-18(27-17)19(22)26-12-11-25-15-5-7-16(8-6-15)28(21,23)24/h1-10H,11-12H2,(H2,21,23,24) |
| InChIKey | YBUQGUZGSJBYBJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|