C14H12FNO3S — CID 18192454
(1-amino-1-oxopropan-2-yl) 5-(4-fluorophenyl)thiophene-2-carboxylate (PubChem CID 18192454) has the molecular formula C14H12FNO3S and a molecular weight of 293.32 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 5-(4-fluorophenyl)thiophene-2-carboxylate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 5-(4-fluorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 18192454 |
| Molecular Formula | C14H12FNO3S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 5-(4-fluorophenyl)thiophene-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(-c2ccc(F)cc2)s1)C(N)=O |
| InChI | InChI=1S/C14H12FNO3S/c1-8(13(16)17)19-14(18)12-7-6-11(20-12)9-2-4-10(15)5-3-9/h2-8H,1H3,(H2,16,17) |
| InChIKey | LQVJTAHDCFGZHR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |